EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:757667 - zotatifin
| Formula | C28H29N3O5 |
| Net Charge | 0 |
| Average Mass | 487.556 |
| Monoisotopic Mass | 487.21072 |
| SMILES | COc1cc2c(c(OC)n1)[C@]1(O)[C@H](O)[C@H](CN(C)C)[C@@H](c3ccccc3)[C@]1(c1ccc(C#N)cc1)O2 |
| InChI | InChI=1S/C28H29N3O5/c1-31(2)16-20-23(18-8-6-5-7-9-18)28(19-12-10-17(15-29)11-13-19)27(33,25(20)32)24-21(36-28)14-22(34-3)30-26(24)35-4/h5-14,20,23,25,32-33H,16H2,1-4H3/t20-,23-,25-,27+,28+/m1/s1 |
| InChIKey | QYCXWOACFWMQFO-WZWZCULESA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zotatifin (CHEBI:757667) has role antineoplastic agent (CHEBI:35610) |
| zotatifin (CHEBI:757667) has role antiviral agent (CHEBI:22587) |
| zotatifin (CHEBI:757667) is a stilbenoid (CHEBI:26776) |
| INNs | Source |
|---|---|
| zotatifin | WHO MedNet |
| zotatifina | WHO MedNet |
| zotatifine | WHO MedNet |
| Synonyms | Source |
|---|---|
| EFT-226 | ChEMBL |
| EFT226 | ChEMBL |
| Citations |
|---|