EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H21F3N6O3S |
| Net Charge | 0 |
| Average Mass | 542.543 |
| Monoisotopic Mass | 542.13479 |
| SMILES | O=C(c1c(F)ccc(NS(=O)(=O)N2CC[C@@H](F)C2)c1F)c1cnc2ncc(-c3cnc(C4CC4)nc3)cc12 |
| InChI | InChI=1S/C25H21F3N6O3S/c26-16-5-6-34(12-16)38(36,37)33-20-4-3-19(27)21(22(20)28)23(35)18-11-32-25-17(18)7-14(8-31-25)15-9-29-24(30-10-15)13-1-2-13/h3-4,7-11,13,16,33H,1-2,5-6,12H2,(H,31,32)/t16-/m1/s1 |
| InChIKey | YYACLQUDUDXAPA-MRXNPFEDSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| plixorafenib (CHEBI:757666) has role antineoplastic agent (CHEBI:35610) |
| plixorafenib (CHEBI:757666) is a aromatic ketone (CHEBI:76224) |
| INN | Source |
|---|---|
| plixorafenib | WHO MedNet |
| Synonyms | Source |
|---|---|
| FORE-8394 | ChEMBL |
| FORE8394 | ChEMBL |
| Plx 8394 | ChEMBL |
| Plx-8394 | ChEMBL |
| PLX8394 | ChEMBL |