EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H11F3N2O |
| Net Charge | 0 |
| Average Mass | 328.293 |
| Monoisotopic Mass | 328.08235 |
| SMILES | O=C(/C=C/c1ccc2ccc(C(F)(F)F)cc2n1)c1ccncc1 |
| InChI | InChI=1S/C18H11F3N2O/c19-18(20,21)14-3-1-12-2-4-15(23-16(12)11-14)5-6-17(24)13-7-9-22-10-8-13/h1-11H/b6-5+ |
| InChIKey | IAJOMYABKVAZCN-AATRIKPKSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pfk-158 (CHEBI:757663) has role antineoplastic agent (CHEBI:35610) |
| pfk-158 (CHEBI:757663) is a quinolines (CHEBI:26513) |
| Synonym | Source |
|---|---|
| Pfk-158 | ChEMBL |
| Citations |
|---|