EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H24Cl2FN5O2 |
| Net Charge | 0 |
| Average Mass | 552.437 |
| Monoisotopic Mass | 551.12911 |
| SMILES | C#CC[C@H](c1nc2cc(Cl)ccc2c(=O)n1Nc1ccccc1)N(CCCN)C(=O)c1cccc(Cl)c1F |
| InChI | InChI=1S/C28H24Cl2FN5O2/c1-2-8-24(35(16-7-15-32)27(37)21-11-6-12-22(30)25(21)31)26-33-23-17-18(29)13-14-20(23)28(38)36(26)34-19-9-4-3-5-10-19/h1,3-6,9-14,17,24,34H,7-8,15-16,32H2/t24-/m1/s1 |
| InChIKey | UPJSUQWHUVLLNW-XMMPIXPASA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| arq-621 (CHEBI:757660) has role antineoplastic agent (CHEBI:35610) |
| arq-621 (CHEBI:757660) is a quinazolines (CHEBI:38530) |
| Synonyms | Source |
|---|---|
| Arq 621 | ChEMBL |
| Arq-621 | ChEMBL |