EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H17N5O5S |
| Net Charge | 0 |
| Average Mass | 355.376 |
| Monoisotopic Mass | 355.09504 |
| SMILES | [H][C@@]12[C@H](Sc3ncnn3)C[C@@](NC(=O)[C@H](C)N)(C(=O)O)[C@]1([H])[C@H]2C(=O)O |
| InChI | InChI=1S/C13H17N5O5S/c1-4(14)9(19)17-13(11(22)23)2-5(24-12-15-3-16-18-12)6-7(8(6)13)10(20)21/h3-8H,2,14H2,1H3,(H,17,19)(H,20,21)(H,22,23)(H,15,16,18)/t4-,5+,6-,7-,8-,13-/m0/s1 |
| InChIKey | BBGHHIUQOKQCBW-LDZWZCGGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ly2979165 (CHEBI:757656) has role antipsychotic agent (CHEBI:35476) |
| ly2979165 (CHEBI:757656) is a dipeptide (CHEBI:46761) |
| Synonyms | Source |
|---|---|
| HY-13239 | ChEMBL |
| Ly2979165 | ChEMBL |
| LY-2979165 | ChEMBL |