EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H16FN7O |
| Net Charge | 0 |
| Average Mass | 401.405 |
| Monoisotopic Mass | 401.14004 |
| SMILES | C[C@H](Nc1ncnc2ncnc12)c1nc2ccc(F)cc2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C21H16FN7O/c1-12(27-19-17-18(24-10-23-17)25-11-26-19)20-28-16-8-7-13(22)9-15(16)21(30)29(20)14-5-3-2-4-6-14/h2-12H,1H3,(H2,23,24,25,26,27)/t12-/m0/s1 |
| InChIKey | DOCINCLJNAXZQF-LBPRGKRZSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acalisib (CHEBI:757655) has role antineoplastic agent (CHEBI:35610) |
| acalisib (CHEBI:757655) is a quinazolines (CHEBI:38530) |
| INN | Source |
|---|---|
| acalisib | WHO MedNet |
| Synonyms | Source |
|---|---|
| CAL-120 | ChEMBL |
| CAL120 | ChEMBL |
| GS-9820 | ChEMBL |
| GS9820 | ChEMBL |
| Citations |
|---|