EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:757652 - cefotiam hydrochloride
| Formula | HCl.HCl.C18H23N9O4S3 |
| Net Charge | 0 |
| Average Mass | 598.564 |
| Monoisotopic Mass | 597.05687 |
| SMILES | Cl.Cl.[H][C@]12SCC(CSc3nnnn3CCN(C)C)=C(C(=O)O)N1C(=O)[C@H]2NC(=O)Cc1csc(N)n1 |
| InChI | InChI=1S/C18H23N9O4S3.2ClH/c1-25(2)3-4-26-18(22-23-24-26)34-7-9-6-32-15-12(14(29)27(15)13(9)16(30)31)21-11(28)5-10-8-33-17(19)20-10;;/h8,12,15H,3-7H2,1-2H3,(H2,19,20)(H,21,28)(H,30,31);2*1H/t12-,15-;;/m1../s1 |
| InChIKey | BWRRTAXZCKVRON-DGPOFWGLSA-N |
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | drug allergen Any drug which causes the onset of an allergic reaction. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefotiam hydrochloride (CHEBI:757652) is a cephalosporin (CHEBI:23066) |
| Synonyms | Source |
|---|---|
| ABBOTT-48999 | ChEMBL |
| Cefotiam dihydrochloride | ChEMBL |
| CGP-14221/E | ChEMBL |
| NSC-758164 | ChEMBL |
| SCE 963 | ChEMBL |
| SCE-963 | ChEMBL |
| Brand Names | Source |
|---|---|
| Ceradon | ChEMBL |
| Pansporin | ChEMBL |
| Citations |
|---|