EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O2 |
| Net Charge | 0 |
| Average Mass | 302.458 |
| Monoisotopic Mass | 302.22458 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C=C/C(C)=C/C(=O)O |
| InChI | InChI=1S/C20H30O2/c1-16(2)9-6-10-17(3)11-7-12-18(4)13-8-14-19(5)15-20(21)22/h8-9,11,13-15H,6-7,10,12H2,1-5H3,(H,21,22)/b14-8+,17-11+,18-13+,19-15+ |
| InChIKey | UUBHZHZSIKRVIV-KCXSXWJSSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| peretinoin (CHEBI:757651) has role antineoplastic agent (CHEBI:35610) |
| peretinoin (CHEBI:757651) is a diterpenoid (CHEBI:23849) |
| INN | Source |
|---|---|
| peretinoin | WHO MedNet |
| Synonym | Source |
|---|---|
| Nik-333 | ChEMBL |