EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H22FN3O3 |
| Net Charge | 0 |
| Average Mass | 407.445 |
| Monoisotopic Mass | 407.16452 |
| SMILES | COc1cc2c(Oc3ccc4nc(C)cc4c3F)ccnc2cc1OCC1(N)CC1 |
| InChI | InChI=1S/C23H22FN3O3/c1-13-9-15-16(27-13)3-4-19(22(15)24)30-18-5-8-26-17-11-21(20(28-2)10-14(17)18)29-12-23(25)6-7-23/h3-5,8-11,27H,6-7,12,25H2,1-2H3 |
| InChIKey | KSMZEXLVHXZPEF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| catequentinib (CHEBI:757650) has role antineoplastic agent (CHEBI:35610) |
| catequentinib (CHEBI:757650) is a aromatic ether (CHEBI:35618) |
| INN | Source |
|---|---|
| catequentinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| AL 3818 | ChEMBL |
| AL-3818 | ChEMBL |
| AL3818 | ChEMBL |
| Anlotinib | ChEMBL |
| Citations |
|---|