EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H19ClN4O2 |
| Net Charge | 0 |
| Average Mass | 394.862 |
| Monoisotopic Mass | 394.11965 |
| SMILES | CN(C)c1cccc(-c2c3c(=O)n(-c4ccccc4Cl)nc3cc(=O)n2C)c1 |
| InChI | InChI=1S/C21H19ClN4O2/c1-24(2)14-8-6-7-13(11-14)20-19-16(12-18(27)25(20)3)23-26(21(19)28)17-10-5-4-9-15(17)22/h4-12,23H,1-3H3 |
| InChIKey | RGYQPQARIQKJKH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antifibrotic agent Any agent which acts to reduce fibrosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| setanaxib (CHEBI:757649) has role antifibrotic agent (CHEBI:233423) |
| setanaxib (CHEBI:757649) has role antineoplastic agent (CHEBI:35610) |
| setanaxib (CHEBI:757649) is a pyrazoles (CHEBI:26410) |
| setanaxib (CHEBI:757649) is a ring assembly (CHEBI:36820) |
| INN | Source |
|---|---|
| setanaxib | WHO MedNet |
| Synonyms | Source |
|---|---|
| GKT-137831 | ChEMBL |
| GKT-831 | ChEMBL |
| Citations |
|---|