EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H30Cl2FN3O3 |
| Net Charge | 0 |
| Average Mass | 498.426 |
| Monoisotopic Mass | 497.16483 |
| SMILES | CCOC(=O)[C@H](Cc1ccc(F)cc1)NC(=O)[C@@H](N)Cc1ccc(N(CCCl)CCCl)cc1 |
| InChI | InChI=1S/C24H30Cl2FN3O3/c1-2-33-24(32)22(16-18-3-7-19(27)8-4-18)29-23(31)21(28)15-17-5-9-20(10-6-17)30(13-11-25)14-12-26/h3-10,21-22H,2,11-16,28H2,1H3,(H,29,31)/t21-,22-/m0/s1 |
| InChIKey | YQZNKYXGZSVEHI-VXKWHMMOSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| melphalan flufenamide (CHEBI:757647) has role antineoplastic agent (CHEBI:35610) |
| melphalan flufenamide (CHEBI:757647) is a peptide (CHEBI:16670) |
| INN | Source |
|---|---|
| melfalan flufenamida | WHO MedNet |
| Synonyms | Source |
|---|---|
| J-1 | ChEMBL |
| J1 | ChEMBL |
| J 1 (PRODRUG) | ChEMBL |
| J-1 (PRODRUG) | ChEMBL |
| J1 (PRODRUG) | ChEMBL |
| Melphalan flufenamide | ChEMBL |
| Citations |
|---|