EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18F3N4O8P |
| Net Charge | 0 |
| Average Mass | 530.352 |
| Monoisotopic Mass | 530.08143 |
| SMILES | CC(=O)OP(=O)(O)N(C[C@H]1CN(c2cc(F)c(N3C=CC(=O)CC3)c(F)c2F)C(=O)O1)c1ccon1 |
| InChI | InChI=1S/C20H18F3N4O8P/c1-11(28)35-36(31,32)27(16-4-7-33-24-16)10-13-9-26(20(30)34-13)15-8-14(21)19(18(23)17(15)22)25-5-2-12(29)3-6-25/h2,4-5,7-8,13H,3,6,9-10H2,1H3,(H,31,32)/t13-/m1/s1 |
| InChIKey | YCRAGJLWFBGKFE-CYBMUJFWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mrx-4 (CHEBI:757639) is a tertiary amine (CHEBI:32876) |
| Synonyms | Source |
|---|---|
| Mrx-4 | ChEMBL |
| Prodrug of contezolid (mrx-1) | ChEMBL |