EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H17BrCl2FN3O5S |
| Net Charge | 0 |
| Average Mass | 629.291 |
| Monoisotopic Mass | 626.94334 |
| SMILES | CCC(=O)NS(=O)(=O)c1ccc(NC(=O)Cc2ccc(Br)c(Oc3cc(Cl)cc(C#N)c3)c2F)c(Cl)c1 |
| InChI | InChI=1S/C24H17BrCl2FN3O5S/c1-2-21(32)31-37(34,35)17-4-6-20(19(27)11-17)30-22(33)9-14-3-5-18(25)24(23(14)28)36-16-8-13(12-29)7-15(26)10-16/h3-8,10-11H,2,9H2,1H3,(H,30,33)(H,31,32) |
| InChIKey | ULTDEARCBRNRGR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| elsulfavirine (CHEBI:757633) has role anti-HIV agent (CHEBI:64946) |
| elsulfavirine (CHEBI:757633) has role antiviral agent (CHEBI:22587) |
| elsulfavirine (CHEBI:757633) is a aromatic ether (CHEBI:35618) |
| elsulfavirine (CHEBI:757633) is a organobromine compound (CHEBI:37141) |
| INN | Source |
|---|---|
| elsulfavirina | WHO MedNet |
| Synonyms | Source |
|---|---|
| Elsulfavirine | ChEMBL |
| R-1206 | ChEMBL |