EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H26N4O3S |
| Net Charge | 0 |
| Average Mass | 450.564 |
| Monoisotopic Mass | 450.17256 |
| SMILES | O=C(c1ccc(NS(=O)(=O)c2cccc3cccnc23)cc1)N1CCN(CC2CC2)CC1 |
| InChI | InChI=1S/C24H26N4O3S/c29-24(28-15-13-27(14-16-28)17-18-6-7-18)20-8-10-21(11-9-20)26-32(30,31)22-5-1-3-19-4-2-12-25-23(19)22/h1-5,8-12,18,26H,6-7,13-17H2 |
| InChIKey | XAYGBKHKBBXDAK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mitapivat (CHEBI:757622) has role anti-anaemic agent (CHEBI:75835) |
| mitapivat (CHEBI:757622) is a quinolines (CHEBI:26513) |
| Synonyms | Source |
|---|---|
| AG-348 | ChEMBL |
| Mitapivat | ChEMBL |
| Pkr-in-1 | ChEMBL |
| Citations |
|---|