EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O7.C23H24N4O |
| Net Charge | 0 |
| Average Mass | 564.595 |
| Monoisotopic Mass | 564.22201 |
| SMILES | CN1C/C=C/CCOc2cccc(c2)-c2ccnc(n2)Nc2cccc(c2)C1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C23H24N4O.C6H8O7/c1-27-13-3-2-4-14-28-21-10-6-8-19(16-21)22-11-12-24-23(26-22)25-20-9-5-7-18(15-20)17-27;7-3(8)1-6(13,5(11)12)2-4(9)10/h2-3,5-12,15-16H,4,13-14,17H2,1H3,(H,24,25,26);13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/b3-2+; |
| InChIKey | NWYDRHSNEATNRI-SQQVDAMQSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zotiraciclib citrate (CHEBI:757581) has role antineoplastic agent (CHEBI:35610) |
| zotiraciclib citrate (CHEBI:757581) is a carbonyl compound (CHEBI:36586) |
| Synonyms | Source |
|---|---|
| Tg-02 citrate | ChEMBL |
| TG02 citrate | ChEMBL |
| Zotiraciclib citrate | ChEMBL |