EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H4O4.C21H23N5O3S |
| Net Charge | 0 |
| Average Mass | 541.586 |
| Monoisotopic Mass | 541.16312 |
| SMILES | O=C(Nc1nc2cccc(-c3ccc(CN4CCS(=O)(=O)CC4)cc3)n2n1)C1CC1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C21H23N5O3S.C4H4O4/c27-20(17-8-9-17)23-21-22-19-3-1-2-18(26(19)24-21)16-6-4-15(5-7-16)14-25-10-12-30(28,29)13-11-25;5-3(6)1-2-4(7)8/h1-7,17H,8-14H2,(H,23,24,27);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | BFENHEAPFWQJFL-BTJKTKAUSA-N |
| Roles Classification |
|---|
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antirheumatic drug A drug used to treat rheumatoid arthritis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| filgotinib maleate (CHEBI:757576) has role anti-inflammatory agent (CHEBI:67079) |
| filgotinib maleate (CHEBI:757576) has role antirheumatic drug (CHEBI:35842) |
| filgotinib maleate (CHEBI:757576) is a triazolopyridine (CHEBI:46746) |
| Synonyms | Source |
|---|---|
| Filgotinib maleate | ChEMBL |
| GS-6034 | ChEMBL |
| Brand Name | Source |
|---|---|
| Jyseleca | ChEMBL |