EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C44H52N2O16S5 |
| Net Charge | 0 |
| Average Mass | 1025.233 |
| Monoisotopic Mass | 1024.19204 |
| SMILES | CC1(C)C(/C=C/C2=C(Oc3ccc(S(=O)(=O)O)cc3)/C(=C/C=C3/N(CCCCS(=O)(=O)O)c4ccc(S(=O)(=O)O)cc4C3(C)C)CCC2)=[N+](CCCCS(=O)(=O)[O-])c2ccc(S(=O)(=O)O)cc21 |
| InChI | InChI=1S/C44H52N2O16S5/c1-43(2)36-28-34(66(56,57)58)18-20-38(36)45(24-5-7-26-63(47,48)49)40(43)22-12-30-10-9-11-31(42(30)62-32-14-16-33(17-15-32)65(53,54)55)13-23-41-44(3,4)37-29-35(67(59,60)61)19-21-39(37)46(41)25-6-8-27-64(50,51)52/h12-23,28-29H,5-11,24-27H2,1-4H3,(H4-,47,48,49,50,51,52,53,54,55,56,57,58,59,60,61) |
| InChIKey | FRMYEKPWHJAHIO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | vulnerary A drug used in treating and healing of wounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nerindocianine (CHEBI:757571) has role vulnerary (CHEBI:73336) |
| nerindocianine (CHEBI:757571) is a indoles (CHEBI:24828) |
| INNs | Source |
|---|---|
| nerindocianina | WHO MedNet |
| nerindocianine | WHO MedNet |
| Synonyms | Source |
|---|---|
| 830-15455 | ChEMBL |
| IRDye 800BK | ChEMBL |