EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H4O4.C24H27F3N8O3 |
| Net Charge | 0 |
| Average Mass | 648.599 |
| Monoisotopic Mass | 648.22678 |
| SMILES | CN1CCN(c2ccc(OC(F)(F)F)c(Nc3ncc4c(n3)-c3c(c(C(N)=O)nn3CCO)CC4)c2)CC1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C24H27F3N8O3.C4H4O4/c1-33-6-8-34(9-7-33)15-3-5-18(38-24(25,26)27)17(12-15)30-23-29-13-14-2-4-16-20(22(28)37)32-35(10-11-36)21(16)19(14)31-23;5-3(6)1-2-4(7)8/h3,5,12-13,36H,2,4,6-11H2,1H3,(H2,28,37)(H,29,30,31);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | LUEMEFHVOJNLJG-WLHGVMLRSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| onvansertib fumarate (CHEBI:757567) has role antineoplastic agent (CHEBI:35610) |
| onvansertib fumarate (CHEBI:757567) is a piperazines (CHEBI:26144) |
| Synonyms | Source |
|---|---|
| Nms-p937 fumarate | ChEMBL |
| Nms-p937 fumarate salt | ChEMBL |
| Onvansertib fumarate | ChEMBL |
| Pcm-075 fumarate | ChEMBL |
| PMS-075H | ChEMBL |