EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H15BrN3O |
| Net Charge | 0 |
| Average Mass | 303.166 |
| Monoisotopic Mass | 302.04079 |
| SMILES | N=C(N)NCc1ccc(OCCC[18F])c(Br)c1 |
| InChI | InChI=1S/C11H15BrFN3O/c12-9-6-8(7-16-11(14)15)2-3-10(9)17-5-1-4-13/h2-3,6H,1,4-5,7H2,(H4,14,15,16)/i13-1 |
| InChIKey | ZYULQCDNUYJBRI-HSGWXFLFSA-N |
| Roles Classification |
|---|
| Application: | diagnostic imaging agent A substance administered to enhance contrast in images of the inside of the body obtained using X-rays, γ-rays, sound waves, radio waves (MRI), or radioactive particles in order to diagnose disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flubrobenguane f18 (CHEBI:757566) has role diagnostic imaging agent (CHEBI:37334) |
| flubrobenguane f18 (CHEBI:757566) is a aromatic ether (CHEBI:35618) |
| INNs | Source |
|---|---|
| flubrobenguane (18f) | WHO MedNet |
| flubrobenguano (18f) | WHO MedNet |
| Synonyms | Source |
|---|---|
| (18F)LMI 1195 | ChEMBL |
| Flubrobenguane f-18 | ChEMBL |
| Flubrobenguane f18 | ChEMBL |
| LMI 1195 | ChEMBL |
| LMI 1195 F-18 | ChEMBL |
| LMI-1195 F-18 | ChEMBL |