EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C20H22ClFN6O2 |
| Net Charge | 0 |
| Average Mass | 469.348 |
| Monoisotopic Mass | 468.12436 |
| SMILES | CCOc1c([C@H](C)n2nc(C)c3c(N)ncnc32)cc(Cl)c(F)c1[C@@H]1CNC(=O)C1.Cl |
| InChI | InChI=1S/C20H22ClFN6O2.ClH/c1-4-30-18-12(6-13(21)17(22)16(18)11-5-14(29)24-7-11)10(3)28-20-15(9(2)27-28)19(23)25-8-26-20;/h6,8,10-11H,4-5,7H2,1-3H3,(H,24,29)(H2,23,25,26);1H/t10-,11-;/m0./s1 |
| InChIKey | TWHUONANZMKBKX-ACMTZBLWSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| parsaclisib hydrochloride (CHEBI:757564) has role antineoplastic agent (CHEBI:35610) |
| parsaclisib hydrochloride (CHEBI:757564) is a pyrrolidines (CHEBI:38260) |
| Synonyms | Source |
|---|---|
| Incb-050465 hydrochloride | ChEMBL |
| INCB050465 hydrochloride | ChEMBL |
| Parsaclisib hydrochloride | ChEMBL |