EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | K.C24H29O5 |
| Net Charge | 0 |
| Average Mass | 436.589 |
| Monoisotopic Mass | 436.16521 |
| SMILES | [H][C@]12C[C@@H](O)[C@H](/C=C/[C@@H](O)[C@@H](C)CC#CC)[C@@]1([H])c1cccc(CCCC(=O)[O-])c1O2.[K+] |
| InChI | InChI=1S/C24H30O5.K/c1-3-4-7-15(2)19(25)13-12-17-20(26)14-21-23(17)18-10-5-8-16(24(18)29-21)9-6-11-22(27)28;/h5,8,10,12-13,15,17,19-21,23,25-26H,6-7,9,11,14H2,1-2H3,(H,27,28);/q;+1/p-1/b13-12+;/t15-,17-,19+,20+,21-,23-;/m0./s1 |
| InChIKey | RSTLTBUTQXBUMK-ZTWNIFTGSA-M |
| Roles Classification |
|---|
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| esuberaprost potassium (CHEBI:757555) has role antihypertensive agent (CHEBI:35674) |
| esuberaprost potassium (CHEBI:757555) is a 1-benzofurans (CHEBI:38830) |
| Synonym | Source |
|---|---|
| Esuberaprost potassium | ChEMBL |