EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H17ClF9N3O3 |
| Net Charge | 0 |
| Average Mass | 625.875 |
| Monoisotopic Mass | 625.08147 |
| SMILES | O=C(CNC(=O)c1ccc(C2=NO[C@@](c3cc(Cl)cc(C(F)(F)F)c3)(C(F)(F)F)C2)c2ccccc12)NCC(F)(F)F |
| InChI | InChI=1S/C26H17ClF9N3O3/c27-15-8-13(7-14(9-15)25(31,32)33)23(26(34,35)36)10-20(39-42-23)18-5-6-19(17-4-2-1-3-16(17)18)22(41)37-11-21(40)38-12-24(28,29)30/h1-9H,10-12H2,(H,37,41)(H,38,40)/t23-/m0/s1 |
| InChIKey | OXDDDHGGRFRLEE-QHCPKHFHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antiparasitic agent A substance used to treat or prevent parasitic infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| esafoxolaner (CHEBI:757554) has role antiparasitic agent (CHEBI:35442) |
| esafoxolaner (CHEBI:757554) is a naphthoic acid (CHEBI:25483) |
| INN | Source |
|---|---|
| esafoxolaner | WHO MedNet |
| Synonym | Source |
|---|---|
| Afoxolaner, (s)- | ChEMBL |