EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Cl.C25H30N3O8 |
| Net Charge | 0 |
| Average Mass | 535.981 |
| Monoisotopic Mass | 535.17214 |
| SMILES | [Cl-].[H][C@]1([C@H](C(=O)OC)c2ccccc2)CCCCN1C(=O)OC[n+]1cccc(C(=O)N[C@@H](CO)C(=O)O)c1 |
| InChI | InChI=1S/C25H29N3O8.ClH/c1-35-24(33)21(17-8-3-2-4-9-17)20-11-5-6-13-28(20)25(34)36-16-27-12-7-10-18(14-27)22(30)26-19(15-29)23(31)32;/h2-4,7-10,12,14,19-21,29H,5-6,11,13,15-16H2,1H3,(H-,26,30,31,32);1H/t19-,20+,21+;/m0./s1 |
| InChIKey | GONQEUJYYMYNMN-HWAJWLCKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| serdexmethylphenidate chloride (CHEBI:757549) is a N-acyl-amino acid (CHEBI:51569) |
| Synonyms | Source |
|---|---|
| KP415 Cl | ChEMBL |
| Serdexmethylphenidate chloride | ChEMBL |
| Brand Name | Source |
|---|---|
| Serdexmethylphenidate chloride component of azstarys | ChEMBL |