EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26N2O7 |
| Net Charge | 0 |
| Average Mass | 418.446 |
| Monoisotopic Mass | 418.17400 |
| SMILES | COCCOC(=O)C1=C(C)NC(C)=C(C(=O)OC(C)C)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H26N2O7/c1-12(2)30-21(25)18-14(4)22-13(3)17(20(24)29-10-9-28-5)19(18)15-7-6-8-16(11-15)23(26)27/h6-8,11-12,19,22H,9-10H2,1-5H3 |
| InChIKey | UIAGMCDKSXEBJQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. |
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nimodipine (CHEBI:7575) has role antihypertensive agent (CHEBI:35674) |
| nimodipine (CHEBI:7575) has role calcium channel blocker (CHEBI:38215) |
| nimodipine (CHEBI:7575) has role cardiovascular drug (CHEBI:35554) |
| nimodipine (CHEBI:7575) has role vasodilator agent (CHEBI:35620) |
| nimodipine (CHEBI:7575) is a C-nitro compound (CHEBI:35716) |
| nimodipine (CHEBI:7575) is a 2-methoxyethyl ester (CHEBI:136838) |
| nimodipine (CHEBI:7575) is a dicarboxylic acids and O-substituted derivatives (CHEBI:131927) |
| nimodipine (CHEBI:7575) is a diester (CHEBI:51307) |
| nimodipine (CHEBI:7575) is a dihydropyridine (CHEBI:50075) |
| nimodipine (CHEBI:7575) is a isopropyl ester (CHEBI:35725) |
| IUPAC Name |
|---|
| 2-methoxyethyl propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| INNs | Source |
|---|---|
| nimodipino | ChemIDplus |
| nimodipinum | ChemIDplus |
| nimodipine | ChemIDplus |
| Synonyms | Source |
|---|---|
| Nimodipine | KEGG COMPOUND |
| isopropyl 2-methoxyethyl 1,4-dihydro-2,6-dimethyl-4-(m-nitrophenyl)-3,5-pyridinedicarboxylate | ChemIDplus |
| isopropyl 2-methoxyethyl 1,4-dihydro-2,6-dimethyl-4-(3-nitrophenyl)-3,5-pyridinedicarboxylate | ChEBI |
| 2,6-dimethyl-4-(3'-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylic acid 3-β-methoxyethyl ester 5-isopropyl ester | ChEBI |
| BAY e 9736 | ChemIDplus |
| Brand Names | Source |
|---|---|
| Periplum | ChemIDplus |
| Nimotop | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:459792 | Reaxys |
| CAS:66085-59-4 | KEGG COMPOUND |
| CAS:66085-59-4 | ChemIDplus |
| CAS:66085-59-4 | NIST Chemistry WebBook |
| Citations |
|---|