EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26N2O7 |
| Net Charge | 0 |
| Average Mass | 418.446 |
| Monoisotopic Mass | 418.17400 |
| SMILES | COCCOC(=O)C1=C(C)NC(C)=C(C(=O)OC(C)C)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H26N2O7/c1-12(2)30-21(25)18-14(4)22-13(3)17(20(24)29-10-9-28-5)19(18)15-7-6-8-16(11-15)23(26)27/h6-8,11-12,19,22H,9-10H2,1-5H3 |
| InChIKey | UIAGMCDKSXEBJQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. vasodilator agent A drug used to cause dilation of the blood vessels. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antidote Any protective agent counteracting or neutralizing the action of poisons. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nimodipine (CHEBI:7575) has role antidote (CHEBI:50247) |
| nimodipine (CHEBI:7575) has role antihypertensive agent (CHEBI:35674) |
| nimodipine (CHEBI:7575) has role antineoplastic agent (CHEBI:35610) |
| nimodipine (CHEBI:7575) has role antipsychotic agent (CHEBI:35476) |
| nimodipine (CHEBI:7575) has role calcium channel blocker (CHEBI:38215) |
| nimodipine (CHEBI:7575) has role cardiovascular drug (CHEBI:35554) |
| nimodipine (CHEBI:7575) has role vasodilator agent (CHEBI:35620) |
| nimodipine (CHEBI:7575) is a C-nitro compound (CHEBI:35716) |
| nimodipine (CHEBI:7575) is a 2-methoxyethyl ester (CHEBI:136838) |
| nimodipine (CHEBI:7575) is a dicarboxylic acids and O-substituted derivatives (CHEBI:131927) |
| nimodipine (CHEBI:7575) is a diester (CHEBI:51307) |
| nimodipine (CHEBI:7575) is a dihydropyridine (CHEBI:50075) |
| nimodipine (CHEBI:7575) is a isopropyl ester (CHEBI:35725) |
| IUPAC Name |
|---|
| 2-methoxyethyl propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| INNs | Source |
|---|---|
| nimodipine | ChemIDplus |
| nimodipino | ChemIDplus |
| nimodipinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2,6-dimethyl-4-(3'-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylic acid 3-β-methoxyethyl ester 5-isopropyl ester | ChEBI |
| Admon | ChEMBL |
| BAY e 9736 | ChemIDplus |
| BAY-E-9736 | ChEMBL |
| isopropyl 2-methoxyethyl 1,4-dihydro-2,6-dimethyl-4-(3-nitrophenyl)-3,5-pyridinedicarboxylate | ChEBI |
| isopropyl 2-methoxyethyl 1,4-dihydro-2,6-dimethyl-4-(m-nitrophenyl)-3,5-pyridinedicarboxylate | ChemIDplus |
| Brand Names | Source |
|---|---|
| Nimotop | ChemIDplus |
| Periplum | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:459792 | Reaxys |
| CAS:66085-59-4 | ChemIDplus |
| CAS:66085-59-4 | NIST Chemistry WebBook |
| CAS:66085-59-4 | KEGG COMPOUND |
| Citations |
|---|