EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26N2O7 |
| Net Charge | 0 |
| Average Mass | 418.446 |
| Monoisotopic Mass | 418.17400 |
| SMILES | COCCOC(=O)C1=C(C)NC(C)=C(C(=O)OC(C)C)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H26N2O7/c1-12(2)30-21(25)18-14(4)22-13(3)17(20(24)29-10-9-28-5)19(18)15-7-6-8-16(11-15)23(26)27/h6-8,11-12,19,22H,9-10H2,1-5H3 |
| InChIKey | UIAGMCDKSXEBJQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. |
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. vasodilator agent A drug used to cause dilation of the blood vessels. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nimodipine (CHEBI:7575) has role antihypertensive agent (CHEBI:35674) |
| nimodipine (CHEBI:7575) has role calcium channel blocker (CHEBI:38215) |
| nimodipine (CHEBI:7575) has role cardiovascular drug (CHEBI:35554) |
| nimodipine (CHEBI:7575) has role vasodilator agent (CHEBI:35620) |
| nimodipine (CHEBI:7575) is a C-nitro compound (CHEBI:35716) |
| nimodipine (CHEBI:7575) is a 2-methoxyethyl ester (CHEBI:136838) |
| nimodipine (CHEBI:7575) is a dicarboxylic acids and O-substituted derivatives (CHEBI:131927) |
| nimodipine (CHEBI:7575) is a diester (CHEBI:51307) |
| nimodipine (CHEBI:7575) is a dihydropyridine (CHEBI:50075) |
| nimodipine (CHEBI:7575) is a isopropyl ester (CHEBI:35725) |
| IUPAC Name |
|---|
| 2-methoxyethyl propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| INNs | Source |
|---|---|
| nimodipine | ChemIDplus |
| nimodipino | ChemIDplus |
| nimodipinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2,6-dimethyl-4-(3'-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylic acid 3-β-methoxyethyl ester 5-isopropyl ester | ChEBI |
| BAY e 9736 | ChemIDplus |
| isopropyl 2-methoxyethyl 1,4-dihydro-2,6-dimethyl-4-(3-nitrophenyl)-3,5-pyridinedicarboxylate | ChEBI |
| isopropyl 2-methoxyethyl 1,4-dihydro-2,6-dimethyl-4-(m-nitrophenyl)-3,5-pyridinedicarboxylate | ChemIDplus |
| Nimodipine | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Nimotop | ChemIDplus |
| Periplum | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:459792 | Reaxys |
| CAS:66085-59-4 | KEGG COMPOUND |
| CAS:66085-59-4 | ChemIDplus |
| CAS:66085-59-4 | NIST Chemistry WebBook |
| Citations |
|---|