EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H26FN7O2 |
| Net Charge | 0 |
| Average Mass | 487.539 |
| Monoisotopic Mass | 487.21320 |
| SMILES | C=CC(=O)Nc1cccc(Oc2nc(Nc3ccc(N4CCN(C)CC4)c(F)c3)nc3nccc23)c1 |
| InChI | InChI=1S/C26H26FN7O2/c1-3-23(35)29-17-5-4-6-19(15-17)36-25-20-9-10-28-24(20)31-26(32-25)30-18-7-8-22(21(27)16-18)34-13-11-33(2)12-14-34/h3-10,15-16H,1,11-14H2,2H3,(H,29,35)(H2,28,30,31,32) |
| InChIKey | UOFYSRZSLXWIQB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| abivertinib (CHEBI:757305) has role antineoplastic agent (CHEBI:35610) |
| abivertinib (CHEBI:757305) has role antiviral agent (CHEBI:22587) |
| abivertinib (CHEBI:757305) is a piperazines (CHEBI:26144) |
| INN | Source |
|---|---|
| abivertinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| A610 | ChEMBL |
| AC-0010 | ChEMBL |
| AC0010 | ChEMBL |
| ACEA100610 | ChEMBL |
| Avitinib | ChEMBL |
| EX-ACEA0010 | ChEMBL |
| Citations |
|---|