EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H18O12 |
| Net Charge | 0 |
| Average Mass | 462.363 |
| Monoisotopic Mass | 462.07983 |
| SMILES | O=C(O)[C@H]1O[C@@H](Oc2cc(-c3cc(=O)c4c(O)cc(O)cc4o3)ccc2O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H18O12/c22-8-4-10(24)15-11(25)6-12(31-14(15)5-8)7-1-2-9(23)13(3-7)32-21-18(28)16(26)17(27)19(33-21)20(29)30/h1-6,16-19,21-24,26-28H,(H,29,30)/t16-,17-,18+,19-,21+/m0/s1 |
| InChIKey | JDOFZOKGCYYUER-ZFORQUDYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| luteolin 3'-O-glucuronide (CHEBI:75726) has role metabolite (CHEBI:25212) |
| luteolin 3'-O-glucuronide (CHEBI:75726) is a luteolin O-glucuronoside (CHEBI:25091) |
| luteolin 3'-O-glucuronide (CHEBI:75726) is a trihydroxyflavone (CHEBI:27116) |
| IUPAC Name |
|---|
| 5-(5,7-dihydroxy-4-oxo-4H-chromen-2-yl)-2-hydroxyphenyl β-D-glucopyranosiduronic acid |
| Synonyms | Source |
|---|---|
| luteolin 3'-O-β-D-glucopyranosiduronic acid | ChEBI |
| luteolin 3'-O-β-D-glucoronopyranoside | ChEBI |
| Luteolin 3'-glucuronide | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMPK12110650 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7060350 | Reaxys |