EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HBr.C22H31N3O6S2 |
| Net Charge | 0 |
| Average Mass | 578.551 |
| Monoisotopic Mass | 577.09159 |
| SMILES | Br.[H][C@]12[C@@H](C)C(SC3CN(C4=NCCS4)C3)=C(C(=O)OCOC(=O)C(C)(C)C)N1C(=O)[C@]2([H])[C@@H](C)O |
| InChI | InChI=1S/C22H31N3O6S2.BrH/c1-11-15-14(12(2)26)18(27)25(15)16(19(28)30-10-31-20(29)22(3,4)5)17(11)33-13-8-24(9-13)21-23-6-7-32-21;/h11-15,26H,6-10H2,1-5H3;1H/t11-,12-,14-,15-;/m1./s1 |
| InChIKey | MMWWBQNLJKFAIN-HXLQFWNVSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tebipenem pivoxil hydrobromide (CHEBI:757135) has role antiinfective agent (CHEBI:35441) |
| tebipenem pivoxil hydrobromide (CHEBI:757135) is a carbapenems (CHEBI:46633) |
| Synonyms | Source |
|---|---|
| SPR-994 | ChEMBL |
| SPR994 | ChEMBL |
| TBPM-PI-HBr | ChEMBL |
| Tebipenem pivoxil hydrobromide | ChEMBL |