EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H23FN4O2 |
| Net Charge | 0 |
| Average Mass | 370.428 |
| Monoisotopic Mass | 370.18050 |
| SMILES | CC#CC(=O)N[C@H]1CCCN(c2c(F)cc(C(N)=O)c3nc(C)c(C)c23)C1 |
| InChI | InChI=1S/C20H23FN4O2/c1-4-6-16(26)24-13-7-5-8-25(10-13)19-15(21)9-14(20(22)27)18-17(19)11(2)12(3)23-18/h9,13,23H,5,7-8,10H2,1-3H3,(H2,22,27)(H,24,26)/t13-/m0/s1 |
| InChIKey | VJPPLCNBDLZIFG-ZDUSSCGKSA-N |
| Roles Classification |
|---|
| Applications: | antirheumatic drug A drug used to treat rheumatoid arthritis. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| branebrutinib (CHEBI:757132) has role antineoplastic agent (CHEBI:35610) |
| branebrutinib (CHEBI:757132) has role antirheumatic drug (CHEBI:35842) |
| branebrutinib (CHEBI:757132) is a indolecarboxamide (CHEBI:46921) |
| INN | Source |
|---|---|
| branebrutinib | WHO MedNet |
| Synonym | Source |
|---|---|
| BMS-986195 | ChEMBL |
| Citations |
|---|