EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H4O4.C25H32N8O |
| Net Charge | 0 |
| Average Mass | 576.658 |
| Monoisotopic Mass | 576.28087 |
| SMILES | CNC(=O)c1nn(C)c2c1C(C)(C)Cc1cnc(Nc3ccc(N4CCN(C)CC4)cc3)nc1-2.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C25H32N8O.C4H4O4/c1-25(2)14-16-15-27-24(29-20(16)22-19(25)21(23(34)26-3)30-32(22)5)28-17-6-8-18(9-7-17)33-12-10-31(4)11-13-33;5-3(6)1-2-4(7)8/h6-9,15H,10-14H2,1-5H3,(H,26,34)(H,27,28,29);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | DGVCEXQFNYYRQI-BTJKTKAUSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| milciclib maleate (CHEBI:757129) has role antineoplastic agent (CHEBI:35610) |
| milciclib maleate (CHEBI:757129) is a piperazines (CHEBI:26144) |
| Synonyms | Source |
|---|---|
| Milciclib maleate | ChEMBL |
| PHA-848125AC | ChEMBL |