EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:757128 - citrulline malate
| Formula | C4H6O5.C6H13N3O3 |
| Net Charge | 0 |
| Average Mass | 309.275 |
| Monoisotopic Mass | 309.11721 |
| SMILES | NC(=O)NCCC[C@H](N)C(=O)O.O=C(O)CC(O)C(=O)O |
| InChI | InChI=1S/C6H13N3O3.C4H6O5/c7-4(5(10)11)2-1-3-9-6(8)12;5-2(4(8)9)1-3(6)7/h4H,1-3,7H2,(H,10,11)(H3,8,9,12);2,5H,1H2,(H,6,7)(H,8,9)/t4-;/m0./s1 |
| InChIKey | DROVUXYZTXCEBX-WCCKRBBISA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| citrulline malate (CHEBI:757128) has role cardiovascular drug (CHEBI:35554) |
| citrulline malate (CHEBI:757128) is a α-amino acid (CHEBI:33704) |
| Synonyms | Source |
|---|---|
| Citrulline malate | ChEMBL |
| Citrulline malate (salt) | ChEMBL |
| L-citrulline dl-malate | ChEMBL |
| L-citrulline malate | ChEMBL |
| Stimol | ChEMBL |