EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C45H49N7O11S.HCl |
| Net Charge | 0 |
| Average Mass | 932.453 |
| Monoisotopic Mass | 931.29775 |
| SMILES | CC[C@@]1(OC(=O)[C@@H](NC(=O)[C@H](Cc2cncn2)NC(=S)Nc2ccc(O[C@H]3O[C@@H](C)[C@@H](O)[C@@H](OC)[C@@H]3O)cc2)C(C)C)C(=O)OCc2c1cc1n(c2=O)Cc2cc3ccccc3nc2-1.Cl |
| InChI | InChI=1S/C45H49N7O11S.ClH/c1-6-45(30-17-33-35-25(15-24-9-7-8-10-31(24)49-35)19-52(33)40(56)29(30)20-60-43(45)58)63-41(57)34(22(2)3)51-39(55)32(16-27-18-46-21-47-27)50-44(64)48-26-11-13-28(14-12-26)62-42-37(54)38(59-5)36(53)23(4)61-42;/h7-15,17-18,21-23,32,34,36-38,42,53-54H,6,16,19-20H2,1-5H3,(H,46,47)(H,51,55)(H2,48,50,64);1H/t23-,32-,34-,36+,37-,38+,42+,45-;/m0./s1 |
| InChIKey | XQWYWSHYKUJQDC-NZGUGFNHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| afeletecan hydrochloride (CHEBI:757126) has role antineoplastic agent (CHEBI:35610) |
| afeletecan hydrochloride (CHEBI:757126) is a depsipeptide (CHEBI:23643) |
| Synonyms | Source |
|---|---|
| Afeletecan hydrochloride | ChEMBL |
| Bay 38-3441 | ChEMBL |
| BAY 56-3722 | ChEMBL |
| BAY-563722 | ChEMBL |
| BAY56-3722 | ChEMBL |