EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:757125 - ambroxol acefyllinate
| Formula | C9H10N4O4.C13H18Br2N2O |
| Net Charge | 0 |
| Average Mass | 616.311 |
| Monoisotopic Mass | 614.04879 |
| SMILES | Cn1c(=O)c2c(ncn2CC(=O)O)n(C)c1=O.Nc1c(Br)cc(Br)cc1CN[C@H]1CC[C@H](O)CC1 |
| InChI | InChI=1S/C13H18Br2N2O.C9H10N4O4/c14-9-5-8(13(16)12(15)6-9)7-17-10-1-3-11(18)4-2-10;1-11-7-6(8(16)12(2)9(11)17)13(4-10-7)3-5(14)15/h5-6,10-11,17-18H,1-4,7,16H2;4H,3H2,1-2H3,(H,14,15)/t10-,11-; |
| InChIKey | IPUHJDQWESJTGD-PFWPSKEQSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ambroxol acefyllinate (CHEBI:757125) is a oxopurine (CHEBI:25810) |
| Synonyms | Source |
|---|---|
| Acebrophylline | ChEMBL |
| Ambromucil | ChEMBL |
| Ambroxol acefyllinate | ChEMBL |
| Ambroxol theophyllinate | ChEMBL |
| Ambroxol-theophylline-7-acetate | ChEMBL |
| Broncomnes | ChEMBL |