EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H24BrClN9O3 |
| Net Charge | +1 |
| Average Mass | 601.873 |
| Monoisotopic Mass | 600.08685 |
| SMILES | Cn1cnc([N+](=O)[O-])c1C[N+](C)(C)C/C=C/C(=O)Nc1cc2c(Nc3ccc(Cl)c(Br)c3)ncnc2cn1 |
| InChI | InChI=1S/C24H23BrClN9O3/c1-33-14-30-24(34(37)38)20(33)12-35(2,3)8-4-5-22(36)32-21-10-16-19(11-27-21)28-13-29-23(16)31-15-6-7-18(26)17(25)9-15/h4-7,9-11,13-14H,8,12H2,1-3H3,(H-,27,28,29,31,32,36)/p+1/b5-4+ |
| InChIKey | MUJMYVFVAWFUJL-SNAWJCMRSA-O |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tarloxotinib (CHEBI:757123) has role antineoplastic agent (CHEBI:35610) |
| tarloxotinib (CHEBI:757123) is a pyridopyrimidine (CHEBI:38932) |
| Synonyms | Source |
|---|---|
| Tarloxotinib | ChEMBL |
| Tarloxotinib cation | ChEMBL |
| Tarloxotinib ion | ChEMBL |