EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C47H56N6O10S |
| Net Charge | 0 |
| Average Mass | 897.064 |
| Monoisotopic Mass | 896.37786 |
| SMILES | [H][C@@]12C[C@@H](Oc3nc(-c4ccc(OC(C)C)cc4)nc4c3oc3ccccc34)CN1C(=O)[C@@H](NC(=O)OC1CCCC1)CCCCC/C=C\[C@]1([H])C[C@@]1(C(=O)NS(=O)(=O)C1(C)CC1)NC2=O |
| InChI | InChI=1S/C47H56N6O10S/c1-28(2)60-32-21-19-29(20-22-32)40-49-38-34-16-11-12-18-37(34)63-39(38)42(50-40)61-33-25-36-41(54)51-47(44(56)52-64(58,59)46(3)23-24-46)26-30(47)13-7-5-4-6-8-17-35(43(55)53(36)27-33)48-45(57)62-31-14-9-10-15-31/h7,11-13,16,18-22,28,30-31,33,35-36H,4-6,8-10,14-15,17,23-27H2,1-3H3,(H,48,57)(H,51,54)(H,52,56)/b13-7-/t30-,33-,35+,36+,47-/m1/s1 |
| InChIKey | GZRNOYTVBWWFLJ-NTPALUMKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| furaprevir (CHEBI:757113) has role antiviral agent (CHEBI:22587) |
| furaprevir (CHEBI:757113) is a cyclic peptide (CHEBI:23449) |
| INN | Source |
|---|---|
| furaprevir | WHO MedNet |
| Synonym | Source |
|---|---|
| TG-2349 | ChEMBL |
| Citations |
|---|