EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H23ClN4O4S |
| Net Charge | 0 |
| Average Mass | 450.948 |
| Monoisotopic Mass | 450.11285 |
| SMILES | C/C(=N\NC(=O)c1cccc(S(=O)(=O)N2CCN(C)CC2)c1)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C20H23ClN4O4S/c1-14(18-13-16(21)6-7-19(18)26)22-23-20(27)15-4-3-5-17(12-15)30(28,29)25-10-8-24(2)9-11-25/h3-7,12-13,26H,8-11H2,1-2H3,(H,23,27)/b22-14+ |
| InChIKey | MVSQDUZRRVBYLA-HYARGMPZSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| seclidemstat (CHEBI:757109) has role antineoplastic agent (CHEBI:35610) |
| seclidemstat (CHEBI:757109) is a sulfonamide (CHEBI:35358) |
| INN | Source |
|---|---|
| seclidemstat | WHO MedNet |
| Synonyms | Source |
|---|---|
| SP-2577 | ChEMBL |
| SP2577 | ChEMBL |
| Citations |
|---|