EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H45N3O7 |
| Net Charge | 0 |
| Average Mass | 571.715 |
| Monoisotopic Mass | 571.32575 |
| SMILES | C/C=C\C[C@@H](C/C=C\NC(=O)[C@@H](NC(=O)/C=C\C=C/C(C)=C/[C@H](C)[C@@H]1CC=C(OC)C(=O)O1)C(C)(C)C)OC(N)=O |
| InChI | InChI=1S/C31H45N3O7/c1-8-9-14-23(40-30(32)38)15-12-19-33-28(36)27(31(4,5)6)34-26(35)16-11-10-13-21(2)20-22(3)24-17-18-25(39-7)29(37)41-24/h8-13,16,18-20,22-24,27H,14-15,17H2,1-7H3,(H2,32,38)(H,33,36)(H,34,35)/b9-8-,13-10-,16-11-,19-12-,21-20+/t22-,23-,24-,27+/m0/s1 |
| InChIKey | IEKGSKLKBICCHQ-BDOJOPHNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| plocabulin (CHEBI:757105) has role antineoplastic agent (CHEBI:35610) |
| plocabulin (CHEBI:757105) is a N-acyl-amino acid (CHEBI:51569) |
| INNs | Source |
|---|---|
| plocabulin | WHO MedNet |
| plocabulina | WHO MedNet |
| plocabuline | WHO MedNet |
| Synonyms | Source |
|---|---|
| J3.348.355D | ChEMBL |
| Pm 060184 | ChEMBL |
| PM-060184 | ChEMBL |
| PM060184 | ChEMBL |
| Citations |
|---|