EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H21ClFN5O3 |
| Net Charge | 0 |
| Average Mass | 481.915 |
| Monoisotopic Mass | 481.13170 |
| SMILES | COc1ccc([C@@H](O)c2cc(-c3ncnc4cc(N5CCOCC5)ccc34)c(F)cc2Cl)nn1 |
| InChI | InChI=1S/C24H21ClFN5O3/c1-33-22-5-4-20(29-30-22)24(32)16-11-17(19(26)12-18(16)25)23-15-3-2-14(10-21(15)27-13-28-23)31-6-8-34-9-7-31/h2-5,10-13,24,32H,6-9H2,1H3/t24-/m0/s1 |
| InChIKey | MOWXJLUYGFNTAL-DEOSSOPVSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nedisertib (CHEBI:757098) has role antineoplastic agent (CHEBI:35610) |
| nedisertib (CHEBI:757098) is a quinazolines (CHEBI:38530) |
| INNs | Source |
|---|---|
| nedisertib | WHO MedNet |
| peposertib | WHO MedNet |
| Synonyms | Source |
|---|---|
| M-3814 | ChEMBL |
| M3814 | ChEMBL |
| MSC 2490484A | ChEMBL |
| MSC-2490484A | ChEMBL |
| MSC2490484A | ChEMBL |
| Citations |
|---|