EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H28O7 |
| Net Charge | 0 |
| Average Mass | 416.470 |
| Monoisotopic Mass | 416.18350 |
| SMILES | CCc1ccc([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1Cc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C23H28O7/c1-2-14-4-5-15(23-22(27)21(26)20(25)19(12-24)30-23)11-16(14)9-13-3-6-17-18(10-13)29-8-7-28-17/h3-6,10-11,19-27H,2,7-9,12H2,1H3/t19-,20-,21+,22-,23+/m1/s1 |
| InChIKey | XFJAMQQAAMJFGB-ZQGJOIPISA-N |
| Roles Classification |
|---|
| Biological Role: | anti-obesity agent Any substance which is used to reduce or control weight. |
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| licogliflozin (CHEBI:757094) has role anti-obesity agent (CHEBI:74518) |
| licogliflozin (CHEBI:757094) has role hypoglycemic agent (CHEBI:35526) |
| licogliflozin (CHEBI:757094) has role renoprotective agent (CHEBI:231911) |
| licogliflozin (CHEBI:757094) is a benzodioxine (CHEBI:64096) |
| INNs | Source |
|---|---|
| licogliflozin | WHO MedNet |
| licogliflozina | WHO MedNet |
| licogliflozine | WHO MedNet |
| Synonyms | Source |
|---|---|
| LIK-066 | ChEMBL |
| LIK066 | ChEMBL |
| Citations |
|---|