EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:757092 - rovatirelin
| Formula | C16H22N4O4S |
| Net Charge | 0 |
| Average Mass | 366.443 |
| Monoisotopic Mass | 366.13618 |
| SMILES | C[C@@H]1OC(=O)N[C@@H]1C(=O)N[C@@H](Cc1cscn1)C(=O)N1CCC[C@H]1C |
| InChI | InChI=1S/C16H22N4O4S/c1-9-4-3-5-20(9)15(22)12(6-11-7-25-8-17-11)18-14(21)13-10(2)24-16(23)19-13/h7-10,12-13H,3-6H2,1-2H3,(H,18,21)(H,19,23)/t9-,10+,12+,13+/m1/s1 |
| InChIKey | WTXWDXWZGJGIHV-URBCHYCLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rovatirelin (CHEBI:757092) is a dipeptide (CHEBI:46761) |
| INNs | Source |
|---|---|
| rovatirelin | WHO MedNet |
| rovatirelina | WHO MedNet |
| rovatireline | WHO MedNet |
| Synonyms | Source |
|---|---|
| KPS-0373 | ChEMBL |
| S-0373 | ChEMBL |