EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:757090 - solriamfetol
| Formula | C10H14N2O2 |
| Net Charge | 0 |
| Average Mass | 194.234 |
| Monoisotopic Mass | 194.10553 |
| SMILES | NC(=O)OC[C@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C10H14N2O2/c11-9(7-14-10(12)13)6-8-4-2-1-3-5-8/h1-5,9H,6-7,11H2,(H2,12,13)/t9-/m1/s1 |
| InChIKey | UCTRAOBQFUDCSR-SECBINFHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| solriamfetol (CHEBI:757090) is a amphetamines (CHEBI:35338) |
| Synonyms | Source |
|---|---|
| ADX-N-05 | ChEMBL |
| JZP-110 | ChEMBL |
| R-228060 | ChEMBL |
| SKL-N-05 | ChEMBL |
| YKP-10A | ChEMBL |
| Citations |
|---|