EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H16F5N7O3 |
| Net Charge | 0 |
| Average Mass | 509.395 |
| Monoisotopic Mass | 509.12348 |
| SMILES | NC(=O)[C@](O)(CNc1nc(-c2cc(-c3ccon3)n(Cc3ccccc3F)n2)ncc1F)C(F)(F)F |
| InChI | InChI=1S/C21H16F5N7O3/c22-12-4-2-1-3-11(12)9-33-16(14-5-6-36-32-14)7-15(31-33)18-28-8-13(23)17(30-18)29-10-20(35,19(27)34)21(24,25)26/h1-8,35H,9-10H2,(H2,27,34)(H,28,29,30)/t20-/m1/s1 |
| InChIKey | YWQFJNWMWZMXRW-HXUWFJFHSA-N |
| Roles Classification |
|---|
| Application: | anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| olinciguat (CHEBI:757086) has functional parent β-amino acid (CHEBI:33706) |
| olinciguat (CHEBI:757086) has role anti-anaemic agent (CHEBI:75835) |
| olinciguat (CHEBI:757086) is a organonitrogen compound (CHEBI:35352) |
| olinciguat (CHEBI:757086) is a organooxygen compound (CHEBI:36963) |
| INN | Source |
|---|---|
| olinciguat | WHO MedNet |
| Synonyms | Source |
|---|---|
| IW-1701 | ChEMBL |
| IW1701 | ChEMBL |
| Citations |
|---|