EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22ClFN6O2 |
| Net Charge | 0 |
| Average Mass | 432.887 |
| Monoisotopic Mass | 432.14768 |
| SMILES | CCOc1c([C@H](C)n2nc(C)c3c(N)ncnc32)cc(Cl)c(F)c1[C@@H]1CNC(=O)C1 |
| InChI | InChI=1S/C20H22ClFN6O2/c1-4-30-18-12(6-13(21)17(22)16(18)11-5-14(29)24-7-11)10(3)28-20-15(9(2)27-28)19(23)25-8-26-20/h6,8,10-11H,4-5,7H2,1-3H3,(H,24,29)(H2,23,25,26)/t10-,11-/m0/s1 |
| InChIKey | ZQPDJCIXJHUERQ-QWRGUYRKSA-N |
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| parsaclisib (CHEBI:757085) has role anti-anaemic agent (CHEBI:75835) |
| parsaclisib (CHEBI:757085) has role antineoplastic agent (CHEBI:35610) |
| parsaclisib (CHEBI:757085) is a pyrrolidines (CHEBI:38260) |
| Synonyms | Source |
|---|---|
| INCB-050465 | ChEMBL |
| INCB050465 | ChEMBL |
| Parsaclisib | ChEMBL |
| Citations |
|---|