EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H15ClN4O2 |
| Net Charge | 0 |
| Average Mass | 354.797 |
| Monoisotopic Mass | 354.08835 |
| SMILES | C[C@H](Nc1ccc(C#N)n(C)c1=O)c1cc2cc(Cl)ccc2nc1=O |
| InChI | InChI=1S/C18H15ClN4O2/c1-10(21-16-6-4-13(9-20)23(2)18(16)25)14-8-11-7-12(19)3-5-15(11)22-17(14)24/h3-8,10,21H,1-2H3,(H,22,24)/t10-/m0/s1 |
| InChIKey | NEQYWYXGTJDAKR-JTQLQIEISA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| olutasidenib (CHEBI:757082) has role antineoplastic agent (CHEBI:35610) |
| olutasidenib (CHEBI:757082) is a quinolines (CHEBI:26513) |
| Synonyms | Source |
|---|---|
| FT-2102 | ChEMBL |
| Olutasidenib | ChEMBL |
| Rezlidhia | ChEMBL |
| Citations |
|---|