EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:757081 - olorofim
| Formula | C28H27FN6O2 |
| Net Charge | 0 |
| Average Mass | 498.562 |
| Monoisotopic Mass | 498.21795 |
| SMILES | Cc1cc(-c2ccccc2)c(C(=O)C(=O)Nc2ccc(N3CCN(c4ncc(F)cn4)CC3)cc2)n1C |
| InChI | InChI=1S/C28H27FN6O2/c1-19-16-24(20-6-4-3-5-7-20)25(33(19)2)26(36)27(37)32-22-8-10-23(11-9-22)34-12-14-35(15-13-34)28-30-17-21(29)18-31-28/h3-11,16-18H,12-15H2,1-2H3,(H,32,37) |
| InChIKey | SUFPWYYDCOKDLL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| olorofim (CHEBI:757081) has role antifungal agent (CHEBI:35718) |
| olorofim (CHEBI:757081) has role antineoplastic agent (CHEBI:35610) |
| olorofim (CHEBI:757081) has role renoprotective agent (CHEBI:231911) |
| olorofim (CHEBI:757081) is a piperazines (CHEBI:26144) |
| INN | Source |
|---|---|
| olorofim | WHO MedNet |
| Synonyms | Source |
|---|---|
| F-901318 | ChEMBL |
| F901318 | ChEMBL |
| Citations |
|---|