EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H27N3O4 |
| Net Charge | 0 |
| Average Mass | 481.552 |
| Monoisotopic Mass | 481.20016 |
| SMILES | O=C(O)c1ccc(CN2C[C@@H]3C[C@H]2CN3Cc2ccc(Oc3ccc(-c4ncco4)cc3)cc2)cc1 |
| InChI | InChI=1S/C29H27N3O4/c33-29(34)23-5-1-20(2-6-23)16-31-18-25-15-24(31)19-32(25)17-21-3-9-26(10-4-21)36-27-11-7-22(8-12-27)28-30-13-14-35-28/h1-14,24-25H,15-19H2,(H,33,34)/t24-,25-/m0/s1 |
| InChIKey | GERJIEKMNDGSCS-DQEYMECFSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acebilustat (CHEBI:757078) has role antiviral agent (CHEBI:22587) |
| acebilustat (CHEBI:757078) is a aromatic ether (CHEBI:35618) |
| INN | Source |
|---|---|
| acebilustat | WHO MedNet |
| Synonyms | Source |
|---|---|
| CTX-4430 | ChEMBL |
| EP-501 | ChEMBL |
| Citations |
|---|