EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H23F3N2O2 |
| Net Charge | 0 |
| Average Mass | 428.454 |
| Monoisotopic Mass | 428.17116 |
| SMILES | O=c1nc(=O)c(Cc2cccc(C(F)(F)F)c2)c([C@H]2CC[C@H](c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C24H23F3N2O2/c25-24(26,27)19-8-4-5-15(13-19)14-20-21(28-23(31)29-22(20)30)18-11-9-17(10-12-18)16-6-2-1-3-7-16/h1-8,13,17-18H,9-12,14H2,(H2,28,29,30,31)/t17-,18- |
| InChIKey | GVVUZBSCYAVFTI-IYARVYRRSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| miricorilant (CHEBI:757076) has role antipsychotic agent (CHEBI:35476) |
| miricorilant (CHEBI:757076) is a diarylheptanoid (CHEBI:78802) |
| INN | Source |
|---|---|
| miricorilant | WHO MedNet |
| Synonyms | Source |
|---|---|
| CORT-118335 | ChEMBL |
| CORT118335 | ChEMBL |