EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H24ClFN2O |
| Net Charge | 0 |
| Average Mass | 410.920 |
| Monoisotopic Mass | 410.15612 |
| SMILES | C[C@@H](C(=O)Nc1ccc(Cl)cc1)C1CCC(c2ccnc3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C24H24ClFN2O/c1-15(24(29)28-20-9-6-18(25)7-10-20)16-2-4-17(5-3-16)21-12-13-27-23-11-8-19(26)14-22(21)23/h6-17H,2-5H2,1H3,(H,28,29)/t15-,16?,17?/m1/s1 |
| InChIKey | KRTIYQIPSAGSBP-KLAILNCOSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| linrodostat (CHEBI:757072) has role antineoplastic agent (CHEBI:35610) |
| linrodostat (CHEBI:757072) is a organochlorine compound (CHEBI:36683) |
| linrodostat (CHEBI:757072) is a quinolines (CHEBI:26513) |
| INN | Source |
|---|---|
| linrodostat | WHO MedNet |
| Synonyms | Source |
|---|---|
| BMS 986205 | ChEMBL |
| BMS-986205 | ChEMBL |
| F 001287 | ChEMBL |
| F-001287 | ChEMBL |
| F001287 | ChEMBL |
| ONO 7701 | ChEMBL |
| Citations |
|---|