EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H15N3O2S |
| Net Charge | 0 |
| Average Mass | 253.327 |
| Monoisotopic Mass | 253.08850 |
| SMILES | CC(C)OCCn1c(=S)nc(=O)c2nccc21 |
| InChI | InChI=1S/C11H15N3O2S/c1-7(2)16-6-5-14-8-3-4-12-9(8)10(15)13-11(14)17/h3-4,7,12H,5-6H2,1-2H3,(H,13,15,17) |
| InChIKey | FVJCUZCRPIMVLB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| verdiperstat (CHEBI:757069) has role antiparkinson drug (CHEBI:48407) |
| verdiperstat (CHEBI:757069) is a pyrrolopyrimidine (CHEBI:38670) |
| INN | Source |
|---|---|
| verdiperstat | WHO MedNet |
| Synonyms | Source |
|---|---|
| Azd 3241 | ChEMBL |
| AZD-3241 | ChEMBL |
| AZD3241 | ChEMBL |
| BHV-3241 | ChEMBL |
| BHV-3421 | ChEMBL |
| Citations |
|---|