EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:757068 - atecegatran metoxil
| Formula | C22H23ClF2N4O5 |
| Net Charge | 0 |
| Average Mass | 496.898 |
| Monoisotopic Mass | 496.13250 |
| SMILES | CONC(=N)c1ccc(CNC(=O)[C@@H]2CCN2C(=O)[C@H](O)c2cc(Cl)cc(OC(F)F)c2)cc1 |
| InChI | InChI=1S/C22H23ClF2N4O5/c1-33-28-19(26)13-4-2-12(3-5-13)11-27-20(31)17-6-7-29(17)21(32)18(30)14-8-15(23)10-16(9-14)34-22(24)25/h2-5,8-10,17-18,22,30H,6-7,11H2,1H3,(H2,26,28)(H,27,31)/t17-,18+/m0/s1 |
| InChIKey | XSNMGLZVFNDDPW-ZWKOTPCHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| atecegatran metoxil (CHEBI:757068) has role anti-arrhythmia drug (CHEBI:38070) |
| atecegatran metoxil (CHEBI:757068) is a α-amino acid (CHEBI:33704) |
| INNs | Source |
|---|---|
| atecegatran metoxil | WHO MedNet |
| atecegatran metoxilo | WHO MedNet |
| Synonyms | Source |
|---|---|
| Atecegatran fexenetil | ChEMBL |
| Azd 0837 | ChEMBL |
| AZD-0837 | ChEMBL |
| AZD0837 | ChEMBL |