EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H26N4O5S |
| Net Charge | 0 |
| Average Mass | 482.562 |
| Monoisotopic Mass | 482.16239 |
| SMILES | Cc1cccc(C)c1N(CC(=O)Nc1ccc(-c2ncon2)cc1)C(=O)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C24H26N4O5S/c1-16-4-3-5-17(2)22(16)28(24(30)19-10-12-34(31,32)13-11-19)14-21(29)26-20-8-6-18(7-9-20)23-25-15-33-27-23/h3-9,15,19H,10-14H2,1-2H3,(H,26,29) |
| InChIKey | MNHNIVNAFBSLLX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amenamevir (CHEBI:757067) has role antiviral agent (CHEBI:22587) |
| amenamevir (CHEBI:757067) is a oxadiazole (CHEBI:46685) |
| amenamevir (CHEBI:757067) is a ring assembly (CHEBI:36820) |
| Synonyms | Source |
|---|---|
| Amenamevir | ChEMBL |
| ASP-2151 | ChEMBL |
| ASP2151 | ChEMBL |
| Citations |
|---|